C32H32N3O+ — CID 158080256
7-[3-methyl-2-(2-methylphenyl)benzimidazol-3-ium-1-yl]-6,8-di(propan-2-yl)-[1]benzofuro[2,3-c]pyridine (PubChem CID 158080256) has the molecular formula C32H32N3O+ and a molecular weight of 474.63 g/mol. Its IUPAC name is 7-[3-methyl-2-(2-methylphenyl)benzimidazol-3-ium-1-yl]-6,8-di(propan-2-yl)-[1]benzofuro[2,3-c]pyridine.
| Compound Name | 7-[3-methyl-2-(2-methylphenyl)benzimidazol-3-ium-1-yl]-6,8-di(propan-2-yl)-[1]benzofuro[2,3-c]pyridine |
|---|---|
| PubChem CID | 158080256 |
| Molecular Formula | C32H32N3O+ |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | 7-[3-methyl-2-(2-methylphenyl)benzimidazol-3-ium-1-yl]-6,8-di(propan-2-yl)-[1]benzofuro[2,3-c]pyridine |
| SMILES | Cc1ccccc1-c1n(-c2c(C(C)C)cc3c(oc4cnccc43)c2C(C)C)c2ccccc2[n+]1C |
| InChI | InChI=1S/C32H32N3O/c1-19(2)24-17-25-23-15-16-33-18-28(23)36-31(25)29(20(3)4)30(24)35-27-14-10-9-13-26(27)34(6)32(35)22-12-8-7-11-21(22)5/h7-20H,1-6H3/q+1 |
| InChIKey | STTQVCNREFHHEA-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|