C32H36N3OSi2+ — CID 140847277
trimethyl-[3-[3-methyl-2-(2-methyl-3-pyridinyl)benzimidazol-3-ium-1-yl]-2-trimethylsilyldibenzofuran-4-yl]silane (PubChem CID 140847277) has the molecular formula C32H36N3OSi2+ and a molecular weight of 534.83 g/mol. Its IUPAC name is trimethyl-[3-[3-methyl-2-(2-methyl-3-pyridinyl)benzimidazol-3-ium-1-yl]-2-trimethylsilyldibenzofuran-4-yl]silane.
| Compound Name | trimethyl-[3-[3-methyl-2-(2-methyl-3-pyridinyl)benzimidazol-3-ium-1-yl]-2-trimethylsilyldibenzofuran-4-yl]silane |
|---|---|
| PubChem CID | 140847277 |
| Molecular Formula | C32H36N3OSi2+ |
| Molecular Weight | 534.83 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | trimethyl-[3-[3-methyl-2-(2-methyl-3-pyridinyl)benzimidazol-3-ium-1-yl]-2-trimethylsilyldibenzofuran-4-yl]silane |
| SMILES | Cc1ncccc1-c1n(-c2c([Si](C)(C)C)cc3c(oc4ccccc43)c2[Si](C)(C)C)c2ccccc2[n+]1C |
| InChI | InChI=1S/C32H36N3OSi2/c1-21-22(15-13-19-33-21)32-34(2)25-16-10-11-17-26(25)35(32)29-28(37(3,4)5)20-24-23-14-9-12-18-27(23)36-30(24)31(29)38(6,7)8/h9-20H,1-8H3/q+1 |
| InChIKey | WOJPCBSYODBSGM-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.83 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|