C41H39N2O+ — CID 166051589
1-methyl-2-[2-methyl-6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)dibenzofuran-3-yl]-3-phenylbenzimidazol-1-ium (PubChem CID 166051589) has the molecular formula C41H39N2O+ and a molecular weight of 575.78 g/mol. Its IUPAC name is 1-methyl-2-[2-methyl-6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)dibenzofuran-3-yl]-3-phenylbenzimidazol-1-ium.
| Compound Name | 1-methyl-2-[2-methyl-6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)dibenzofuran-3-yl]-3-phenylbenzimidazol-1-ium |
|---|---|
| PubChem CID | 166051589 |
| Molecular Formula | C41H39N2O+ |
| Molecular Weight | 575.78 g/mol |
| Exact Mass | 575.31 |
| IUPAC Name | 1-methyl-2-[2-methyl-6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)dibenzofuran-3-yl]-3-phenylbenzimidazol-1-ium |
| SMILES | Cc1cc2c(cc1-c1n(-c3ccccc3)c3ccccc3[n+]1C)oc1c(-c3ccc4c(c3)C(C)(C)CCC4(C)C)cccc12 |
| InChI | InChI=1S/C41H39N2O/c1-26-23-32-30-16-12-15-29(27-19-20-33-34(24-27)41(4,5)22-21-40(33,2)3)38(30)44-37(32)25-31(26)39-42(6)35-17-10-11-18-36(35)43(39)28-13-8-7-9-14-28/h7-20,23-25H,21-22H2,1-6H3/q+1 |
| InChIKey | MTHRTQIBACIRGL-UHFFFAOYSA-N |
| XLogP | 10.35 |
| TPSA | 21.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.78 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|