C54H40N4+2 — CID 123805851
1-methyl-2-[4-[10-[4-(1-methyl-3-phenylbenzimidazol-1-ium-2-yl)phenyl]anthracen-9-yl]phenyl]-3-phenylbenzimidazol-1-ium (PubChem CID 123805851) has the molecular formula C54H40N4+2 and a molecular weight of 744.94 g/mol. Its IUPAC name is 1-methyl-2-[4-[10-[4-(1-methyl-3-phenylbenzimidazol-1-ium-2-yl)phenyl]anthracen-9-yl]phenyl]-3-phenylbenzimidazol-1-ium.
| Compound Name | 1-methyl-2-[4-[10-[4-(1-methyl-3-phenylbenzimidazol-1-ium-2-yl)phenyl]anthracen-9-yl]phenyl]-3-phenylbenzimidazol-1-ium |
|---|---|
| PubChem CID | 123805851 |
| Molecular Formula | C54H40N4+2 |
| Molecular Weight | 744.94 g/mol |
| Exact Mass | 744.32 |
| IUPAC Name | 1-methyl-2-[4-[10-[4-(1-methyl-3-phenylbenzimidazol-1-ium-2-yl)phenyl]anthracen-9-yl]phenyl]-3-phenylbenzimidazol-1-ium |
| SMILES | C[n+]1c(-c2ccc(-c3c4ccccc4c(-c4ccc(-c5n(-c6ccccc6)c6ccccc6[n+]5C)cc4)c4ccccc34)cc2)n(-c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C54H40N4/c1-55-47-25-13-15-27-49(47)57(41-17-5-3-6-18-41)53(55)39-33-29-37(30-34-39)51-43-21-9-11-23-45(43)52(46-24-12-10-22-44(46)51)38-31-35-40(36-32-38)54-56(2)48-26-14-16-28-50(48)58(54)42-19-7-4-8-20-42/h3-36H,1-2H3/q+2 |
| InChIKey | NHOIWWPMDBEFAF-UHFFFAOYSA-N |
| XLogP | 12.20 |
| TPSA | 17.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.94 |
| LogP ≤ 5 | 12.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|