C37H30N3+ — CID 123703734
2-[1-(2,6-diphenylphenyl)-3-methylpyrrol-2-yl]-1-methyl-3-phenylbenzimidazol-1-ium (PubChem CID 123703734) has the molecular formula C37H30N3+ and a molecular weight of 516.67 g/mol. Its IUPAC name is 2-[1-(2,6-diphenylphenyl)-3-methylpyrrol-2-yl]-1-methyl-3-phenylbenzimidazol-1-ium.
| Compound Name | 2-[1-(2,6-diphenylphenyl)-3-methylpyrrol-2-yl]-1-methyl-3-phenylbenzimidazol-1-ium |
|---|---|
| PubChem CID | 123703734 |
| Molecular Formula | C37H30N3+ |
| Molecular Weight | 516.67 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | 2-[1-(2,6-diphenylphenyl)-3-methylpyrrol-2-yl]-1-methyl-3-phenylbenzimidazol-1-ium |
| SMILES | Cc1ccn(-c2c(-c3ccccc3)cccc2-c2ccccc2)c1-c1n(-c2ccccc2)c2ccccc2[n+]1C |
| InChI | InChI=1S/C37H30N3/c1-27-25-26-39(35(27)37-38(2)33-23-12-13-24-34(33)40(37)30-19-10-5-11-20-30)36-31(28-15-6-3-7-16-28)21-14-22-32(36)29-17-8-4-9-18-29/h3-26H,1-2H3/q+1 |
| InChIKey | VLKVVGFXXXGXJI-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 13.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.67 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|