C36H35N3+2 — CID 153276083
2-[6-[1,1-bis(2-methylphenyl)ethyl]-1-methylpyridin-1-ium-2-yl]-1-methyl-3-phenylbenzimidazol-1-ium (PubChem CID 153276083) has the molecular formula C36H35N3+2 and a molecular weight of 509.70 g/mol. Its IUPAC name is 2-[6-[1,1-bis(2-methylphenyl)ethyl]-1-methylpyridin-1-ium-2-yl]-1-methyl-3-phenylbenzimidazol-1-ium.
| Compound Name | 2-[6-[1,1-bis(2-methylphenyl)ethyl]-1-methylpyridin-1-ium-2-yl]-1-methyl-3-phenylbenzimidazol-1-ium |
|---|---|
| PubChem CID | 153276083 |
| Molecular Formula | C36H35N3+2 |
| Molecular Weight | 509.70 g/mol |
| Exact Mass | 509.28 |
| IUPAC Name | 2-[6-[1,1-bis(2-methylphenyl)ethyl]-1-methylpyridin-1-ium-2-yl]-1-methyl-3-phenylbenzimidazol-1-ium |
| SMILES | Cc1ccccc1C(C)(c1ccccc1C)c1cccc(-c2n(-c3ccccc3)c3ccccc3[n+]2C)[n+]1C |
| InChI | InChI=1S/C36H35N3/c1-26-16-9-11-20-29(26)36(3,30-21-12-10-17-27(30)2)34-25-15-24-33(37(34)4)35-38(5)31-22-13-14-23-32(31)39(35)28-18-7-6-8-19-28/h6-25H,1-5H3/q+2 |
| InChIKey | ITHSQZUQGJFLOD-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 12.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.70 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|