C22H20FN2+ — CID 170660590
1-(2,6-dimethylphenyl)-2-(3-fluorophenyl)-3-methylbenzimidazol-3-ium (PubChem CID 170660590) has the molecular formula C22H20FN2+ and a molecular weight of 331.41 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-2-(3-fluorophenyl)-3-methylbenzimidazol-3-ium.
| Compound Name | 1-(2,6-dimethylphenyl)-2-(3-fluorophenyl)-3-methylbenzimidazol-3-ium |
|---|---|
| PubChem CID | 170660590 |
| Molecular Formula | C22H20FN2+ |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-2-(3-fluorophenyl)-3-methylbenzimidazol-3-ium |
| SMILES | Cc1cccc(C)c1-n1c(-c2cccc(F)c2)[n+](C)c2ccccc21 |
| InChI | InChI=1S/C22H20FN2/c1-15-8-6-9-16(2)21(15)25-20-13-5-4-12-19(20)24(3)22(25)17-10-7-11-18(23)14-17/h4-14H,1-3H3/q+1 |
| InChIKey | QIUKHRWBLVSSOD-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|