C27H25N4+ — CID 157185335
1-methyl-2-(2-methylphenyl)-3-[2-phenyl-4,6-bis(trideuteriomethyl)pyrimidin-5-yl]benzimidazol-1-ium (PubChem CID 157185335) has the molecular formula C27H25N4+ and a molecular weight of 411.56 g/mol. Its IUPAC name is 1-methyl-2-(2-methylphenyl)-3-[2-phenyl-4,6-bis(trideuteriomethyl)pyrimidin-5-yl]benzimidazol-1-ium.
| Compound Name | 1-methyl-2-(2-methylphenyl)-3-[2-phenyl-4,6-bis(trideuteriomethyl)pyrimidin-5-yl]benzimidazol-1-ium |
|---|---|
| PubChem CID | 157185335 |
| Molecular Formula | C27H25N4+ |
| Molecular Weight | 411.56 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | 1-methyl-2-(2-methylphenyl)-3-[2-phenyl-4,6-bis(trideuteriomethyl)pyrimidin-5-yl]benzimidazol-1-ium |
| SMILES | [2H]C([2H])([2H])c1nc(-c2ccccc2)nc(C([2H])([2H])[2H])c1-n1c(-c2ccccc2C)[n+](C)c2ccccc21 |
| InChI | InChI=1S/C27H25N4/c1-18-12-8-9-15-22(18)27-30(4)23-16-10-11-17-24(23)31(27)25-19(2)28-26(29-20(25)3)21-13-6-5-7-14-21/h5-17H,1-4H3/q+1/i2D3,3D3 |
| InChIKey | XOQUBABNLFFXHA-XERRXZQWSA-N |
| XLogP | 5.50 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.56 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|