C26H29N4+ — CID 157092016
1-(3-cyclohexyl-5-methylpyrazin-2-yl)-3-methyl-2-(2-methylphenyl)benzimidazol-3-ium (PubChem CID 157092016) has the molecular formula C26H29N4+ and a molecular weight of 397.55 g/mol. Its IUPAC name is 1-(3-cyclohexyl-5-methylpyrazin-2-yl)-3-methyl-2-(2-methylphenyl)benzimidazol-3-ium.
| Compound Name | 1-(3-cyclohexyl-5-methylpyrazin-2-yl)-3-methyl-2-(2-methylphenyl)benzimidazol-3-ium |
|---|---|
| PubChem CID | 157092016 |
| Molecular Formula | C26H29N4+ |
| Molecular Weight | 397.55 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | 1-(3-cyclohexyl-5-methylpyrazin-2-yl)-3-methyl-2-(2-methylphenyl)benzimidazol-3-ium |
| SMILES | Cc1cnc(-n2c(-c3ccccc3C)[n+](C)c3ccccc32)c(C2CCCCC2)n1 |
| InChI | InChI=1S/C26H29N4/c1-18-11-7-8-14-21(18)26-29(3)22-15-9-10-16-23(22)30(26)25-24(28-19(2)17-27-25)20-12-5-4-6-13-20/h7-11,14-17,20H,4-6,12-13H2,1-3H3/q+1 |
| InChIKey | LYZJXNXLNZYKEM-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.55 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|