C35H36N3S+ — CID 160660789
2,6-dimethyl-5-[1-methyl-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-1-ium-2-yl]-1,3-benzothiazole (PubChem CID 160660789) has the molecular formula C35H36N3S+ and a molecular weight of 530.76 g/mol. Its IUPAC name is 2,6-dimethyl-5-[1-methyl-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-1-ium-2-yl]-1,3-benzothiazole.
| Compound Name | 2,6-dimethyl-5-[1-methyl-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-1-ium-2-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 160660789 |
| Molecular Formula | C35H36N3S+ |
| Molecular Weight | 530.76 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | 2,6-dimethyl-5-[1-methyl-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-1-ium-2-yl]-1,3-benzothiazole |
| SMILES | Cc1nc2cc(-c3n(-c4c(C(C)C)cc(-c5ccccc5)cc4C(C)C)c4ccccc4[n+]3C)c(C)cc2s1 |
| InChI | InChI=1S/C35H36N3S/c1-21(2)27-18-26(25-13-9-8-10-14-25)19-28(22(3)4)34(27)38-32-16-12-11-15-31(32)37(7)35(38)29-20-30-33(17-23(29)5)39-24(6)36-30/h8-22H,1-7H3/q+1 |
| InChIKey | UYFNUFQCKHLBAL-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.76 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|