C34H36FN2+ — CID 176787504
2-[4-fluoro-2-methyl-5-[4-phenyl-2,6-di(propan-2-yl)phenyl]phenyl]-1,3-dimethylbenzimidazol-3-ium (PubChem CID 176787504) has the molecular formula C34H36FN2+ and a molecular weight of 491.67 g/mol. Its IUPAC name is 2-[4-fluoro-2-methyl-5-[4-phenyl-2,6-di(propan-2-yl)phenyl]phenyl]-1,3-dimethylbenzimidazol-3-ium.
| Compound Name | 2-[4-fluoro-2-methyl-5-[4-phenyl-2,6-di(propan-2-yl)phenyl]phenyl]-1,3-dimethylbenzimidazol-3-ium |
|---|---|
| PubChem CID | 176787504 |
| Molecular Formula | C34H36FN2+ |
| Molecular Weight | 491.67 g/mol |
| Exact Mass | 491.29 |
| IUPAC Name | 2-[4-fluoro-2-methyl-5-[4-phenyl-2,6-di(propan-2-yl)phenyl]phenyl]-1,3-dimethylbenzimidazol-3-ium |
| SMILES | Cc1cc(F)c(-c2c(C(C)C)cc(-c3ccccc3)cc2C(C)C)cc1-c1n(C)c2ccccc2[n+]1C |
| InChI | InChI=1S/C34H36FN2/c1-21(2)26-18-25(24-13-9-8-10-14-24)19-27(22(3)4)33(26)29-20-28(23(5)17-30(29)35)34-36(6)31-15-11-12-16-32(31)37(34)7/h8-22H,1-7H3/q+1 |
| InChIKey | SFYXMIFJRWQNFR-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.67 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|