C16H17N2+ — CID 102032328
1,3-dimethyl-2-(3-methylphenyl)benzimidazol-3-ium (PubChem CID 102032328) has the molecular formula C16H17N2+ and a molecular weight of 237.33 g/mol. Its IUPAC name is 1,3-dimethyl-2-(3-methylphenyl)benzimidazol-3-ium.
| Compound Name | 1,3-dimethyl-2-(3-methylphenyl)benzimidazol-3-ium |
|---|---|
| PubChem CID | 102032328 |
| Molecular Formula | C16H17N2+ |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 1,3-dimethyl-2-(3-methylphenyl)benzimidazol-3-ium |
| SMILES | Cc1cccc(-c2n(C)c3ccccc3[n+]2C)c1 |
| InChI | InChI=1S/C16H17N2/c1-12-7-6-8-13(11-12)16-17(2)14-9-4-5-10-15(14)18(16)3/h4-11H,1-3H3/q+1 |
| InChIKey | ITFDBPWQOUHYFZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|