C27H33N2Si+ — CID 176787499
[4-[4-(1,3-dimethylbenzimidazol-3-ium-2-yl)-3-methylphenyl]-3,5-dimethylphenyl]-trimethylsilane (PubChem CID 176787499) has the molecular formula C27H33N2Si+ and a molecular weight of 413.66 g/mol. Its IUPAC name is [4-[4-(1,3-dimethylbenzimidazol-3-ium-2-yl)-3-methylphenyl]-3,5-dimethylphenyl]-trimethylsilane.
| Compound Name | [4-[4-(1,3-dimethylbenzimidazol-3-ium-2-yl)-3-methylphenyl]-3,5-dimethylphenyl]-trimethylsilane |
|---|---|
| PubChem CID | 176787499 |
| Molecular Formula | C27H33N2Si+ |
| Molecular Weight | 413.66 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | [4-[4-(1,3-dimethylbenzimidazol-3-ium-2-yl)-3-methylphenyl]-3,5-dimethylphenyl]-trimethylsilane |
| SMILES | Cc1cc(-c2c(C)cc([Si](C)(C)C)cc2C)ccc1-c1n(C)c2ccccc2[n+]1C |
| InChI | InChI=1S/C27H33N2Si/c1-18-15-21(26-19(2)16-22(17-20(26)3)30(6,7)8)13-14-23(18)27-28(4)24-11-9-10-12-25(24)29(27)5/h9-17H,1-8H3/q+1 |
| InChIKey | MQVYXFXTUJBGLK-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.66 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|