C38H34FN2O+ — CID 171407220
2-[1-tert-butyl-7-fluoro-3-methyl-6-(4-phenylphenyl)dibenzofuran-4-yl]-1,3-dimethylbenzimidazol-3-ium (PubChem CID 171407220) has the molecular formula C38H34FN2O+ and a molecular weight of 553.70 g/mol. Its IUPAC name is 2-[1-tert-butyl-7-fluoro-3-methyl-6-(4-phenylphenyl)dibenzofuran-4-yl]-1,3-dimethylbenzimidazol-3-ium.
| Compound Name | 2-[1-tert-butyl-7-fluoro-3-methyl-6-(4-phenylphenyl)dibenzofuran-4-yl]-1,3-dimethylbenzimidazol-3-ium |
|---|---|
| PubChem CID | 171407220 |
| Molecular Formula | C38H34FN2O+ |
| Molecular Weight | 553.70 g/mol |
| Exact Mass | 553.26 |
| IUPAC Name | 2-[1-tert-butyl-7-fluoro-3-methyl-6-(4-phenylphenyl)dibenzofuran-4-yl]-1,3-dimethylbenzimidazol-3-ium |
| SMILES | Cc1cc(C(C)(C)C)c2c(oc3c(-c4ccc(-c5ccccc5)cc4)c(F)ccc32)c1-c1n(C)c2ccccc2[n+]1C |
| InChI | InChI=1S/C38H34FN2O/c1-23-22-28(38(2,3)4)34-27-20-21-29(39)33(26-18-16-25(17-19-26)24-12-8-7-9-13-24)35(27)42-36(34)32(23)37-40(5)30-14-10-11-15-31(30)41(37)6/h7-22H,1-6H3/q+1 |
| InChIKey | FYWKFKBFXHOFBN-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 21.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.70 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|