C34H37N4O+ — CID 176787709
2-[6-(2,6-ditert-butylpyrimidin-4-yl)-3-methyldibenzofuran-4-yl]-1,3-dimethylbenzimidazol-3-ium (PubChem CID 176787709) has the molecular formula C34H37N4O+ and a molecular weight of 517.70 g/mol. Its IUPAC name is 2-[6-(2,6-ditert-butylpyrimidin-4-yl)-3-methyldibenzofuran-4-yl]-1,3-dimethylbenzimidazol-3-ium.
| Compound Name | 2-[6-(2,6-ditert-butylpyrimidin-4-yl)-3-methyldibenzofuran-4-yl]-1,3-dimethylbenzimidazol-3-ium |
|---|---|
| PubChem CID | 176787709 |
| Molecular Formula | C34H37N4O+ |
| Molecular Weight | 517.70 g/mol |
| Exact Mass | 517.30 |
| IUPAC Name | 2-[6-(2,6-ditert-butylpyrimidin-4-yl)-3-methyldibenzofuran-4-yl]-1,3-dimethylbenzimidazol-3-ium |
| SMILES | Cc1ccc2c(oc3c(-c4cc(C(C)(C)C)nc(C(C)(C)C)n4)cccc32)c1-c1n(C)c2ccccc2[n+]1C |
| InChI | InChI=1S/C34H37N4O/c1-20-17-18-22-21-13-12-14-23(24-19-27(33(2,3)4)36-32(35-24)34(5,6)7)29(21)39-30(22)28(20)31-37(8)25-15-10-11-16-26(25)38(31)9/h10-19H,1-9H3/q+1 |
| InChIKey | VFLWHMUTDFWPRD-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 47.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.70 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|