C26H22N3O+ — CID 159001297
9-(1,3-dimethylbenzimidazol-3-ium-2-yl)-8,14-dimethyl-11-oxa-13-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaene (PubChem CID 159001297) has the molecular formula C26H22N3O+ and a molecular weight of 392.48 g/mol. Its IUPAC name is 9-(1,3-dimethylbenzimidazol-3-ium-2-yl)-8,14-dimethyl-11-oxa-13-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaene.
| Compound Name | 9-(1,3-dimethylbenzimidazol-3-ium-2-yl)-8,14-dimethyl-11-oxa-13-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaene |
|---|---|
| PubChem CID | 159001297 |
| Molecular Formula | C26H22N3O+ |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 9-(1,3-dimethylbenzimidazol-3-ium-2-yl)-8,14-dimethyl-11-oxa-13-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaene |
| SMILES | Cc1ccc2c(n1)oc1c(-c3n(C)c4ccccc4[n+]3C)c(C)c3ccccc3c12 |
| InChI | InChI=1S/C26H22N3O/c1-15-13-14-19-23-18-10-6-5-9-17(18)16(2)22(24(23)30-25(19)27-15)26-28(3)20-11-7-8-12-21(20)29(26)4/h5-14H,1-4H3/q+1 |
| InChIKey | FGHYTDGFFRUGJZ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|