C34H36N3O+ — CID 157294160
8-[1-[2,6-bis(1,1,1,2-tetradeuteriopropan-2-yl)phenyl]-3-methylbenzimidazol-3-ium-2-yl]-2,7-dimethyl-5-(trideuteriomethyl)-[1]benzofuro[2,3-b]pyridine (PubChem CID 157294160) has the molecular formula C34H36N3O+ and a molecular weight of 513.75 g/mol. Its IUPAC name is 8-[1-[2,6-bis(1,1,1,2-tetradeuteriopropan-2-yl)phenyl]-3-methylbenzimidazol-3-ium-2-yl]-2,7-dimethyl-5-(trideuteriomethyl)-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 8-[1-[2,6-bis(1,1,1,2-tetradeuteriopropan-2-yl)phenyl]-3-methylbenzimidazol-3-ium-2-yl]-2,7-dimethyl-5-(trideuteriomethyl)-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 157294160 |
| Molecular Formula | C34H36N3O+ |
| Molecular Weight | 513.75 g/mol |
| Exact Mass | 513.35 |
| IUPAC Name | 8-[1-[2,6-bis(1,1,1,2-tetradeuteriopropan-2-yl)phenyl]-3-methylbenzimidazol-3-ium-2-yl]-2,7-dimethyl-5-(trideuteriomethyl)-[1]benzofuro[2,3-b]pyridine |
| SMILES | [2H]C([2H])([2H])c1cc(C)c(-c2n(-c3c(C([2H])(C)C([2H])([2H])[2H])cccc3C([2H])(C)C([2H])([2H])[2H])c3ccccc3[n+]2C)c2oc3nc(C)ccc3c12 |
| InChI | InChI=1S/C34H36N3O/c1-19(2)24-12-11-13-25(20(3)4)31(24)37-28-15-10-9-14-27(28)36(8)34(37)30-22(6)18-21(5)29-26-17-16-23(7)35-33(26)38-32(29)30/h9-20H,1-8H3/q+1/i1D3,3D3,5D3,19D,20D |
| InChIKey | CRDQBZWPIXEAMQ-CHWPMYCRSA-N |
| XLogP | 8.59 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.75 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|