C39H37N2O+ — CID 166564040
1-[2,6-bis(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)phenyl]-3-methyl-2-(3-methyl-7-phenyldibenzofuran-4-yl)benzimidazol-3-ium (PubChem CID 166564040) has the molecular formula C39H37N2O+ and a molecular weight of 563.82 g/mol. Its IUPAC name is 1-[2,6-bis(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)phenyl]-3-methyl-2-(3-methyl-7-phenyldibenzofuran-4-yl)benzimidazol-3-ium.
| Compound Name | 1-[2,6-bis(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)phenyl]-3-methyl-2-(3-methyl-7-phenyldibenzofuran-4-yl)benzimidazol-3-ium |
|---|---|
| PubChem CID | 166564040 |
| Molecular Formula | C39H37N2O+ |
| Molecular Weight | 563.82 g/mol |
| Exact Mass | 563.38 |
| IUPAC Name | 1-[2,6-bis(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)phenyl]-3-methyl-2-(3-methyl-7-phenyldibenzofuran-4-yl)benzimidazol-3-ium |
| SMILES | [2H]C([2H])([2H])C([2H])(c1cccc(C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])c1-n1c(-c2c(C)ccc3c2oc2cc(-c4ccccc4)ccc23)[n+](C)c2ccccc21)C([2H])([2H])[2H] |
| InChI | InChI=1S/C39H37N2O/c1-24(2)29-15-12-16-30(25(3)4)37(29)41-34-18-11-10-17-33(34)40(6)39(41)36-26(5)19-21-32-31-22-20-28(23-35(31)42-38(32)36)27-13-8-7-9-14-27/h7-25H,1-6H3/q+1/i1D3,2D3,3D3,4D3,24D,25D |
| InChIKey | FCFFZAOFGVYTSK-WOEYHXPXSA-N |
| XLogP | 10.24 |
| TPSA | 21.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.82 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|