C45H39N2O2+ — CID 169322435
1-methyl-2-(3-methyldibenzofuran-4-yl)-3-[7-phenyl-1,3-di(propan-2-yl)dibenzofuran-2-yl]benzimidazol-1-ium (PubChem CID 169322435) has the molecular formula C45H39N2O2+ and a molecular weight of 639.82 g/mol. Its IUPAC name is 1-methyl-2-(3-methyldibenzofuran-4-yl)-3-[7-phenyl-1,3-di(propan-2-yl)dibenzofuran-2-yl]benzimidazol-1-ium.
| Compound Name | 1-methyl-2-(3-methyldibenzofuran-4-yl)-3-[7-phenyl-1,3-di(propan-2-yl)dibenzofuran-2-yl]benzimidazol-1-ium |
|---|---|
| PubChem CID | 169322435 |
| Molecular Formula | C45H39N2O2+ |
| Molecular Weight | 639.82 g/mol |
| Exact Mass | 639.30 |
| IUPAC Name | 1-methyl-2-(3-methyldibenzofuran-4-yl)-3-[7-phenyl-1,3-di(propan-2-yl)dibenzofuran-2-yl]benzimidazol-1-ium |
| SMILES | Cc1ccc2c(oc3ccccc32)c1-c1n(-c2c(C(C)C)cc3oc4cc(-c5ccccc5)ccc4c3c2C(C)C)c2ccccc2[n+]1C |
| InChI | InChI=1S/C45H39N2O2/c1-26(2)34-25-39-42(33-23-21-30(24-38(33)48-39)29-14-8-7-9-15-29)40(27(3)4)43(34)47-36-18-12-11-17-35(36)46(6)45(47)41-28(5)20-22-32-31-16-10-13-19-37(31)49-44(32)41/h7-27H,1-6H3/q+1 |
| InChIKey | NOGMRXUMVYARER-UHFFFAOYSA-N |
| XLogP | 12.14 |
| TPSA | 35.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.82 |
| LogP ≤ 5 | 12.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|