C24H21N2O+ — CID 140802292
2,6,7-trimethyl-8-(1-methylquinolin-1-ium-2-yl)-[1]benzofuro[2,3-b]pyridine (PubChem CID 140802292) has the molecular formula C24H21N2O+ and a molecular weight of 353.45 g/mol. Its IUPAC name is 2,6,7-trimethyl-8-(1-methylquinolin-1-ium-2-yl)-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 2,6,7-trimethyl-8-(1-methylquinolin-1-ium-2-yl)-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 140802292 |
| Molecular Formula | C24H21N2O+ |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 2,6,7-trimethyl-8-(1-methylquinolin-1-ium-2-yl)-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1ccc2c(n1)oc1c(-c3ccc4ccccc4[n+]3C)c(C)c(C)cc12 |
| InChI | InChI=1S/C24H21N2O/c1-14-13-19-18-11-9-15(2)25-24(18)27-23(19)22(16(14)3)21-12-10-17-7-5-6-8-20(17)26(21)4/h5-13H,1-4H3/q+1 |
| InChIKey | ZECHTJQLNZAJRW-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|