C23H16F2NO+ — CID 147549881
2-(1,7-difluoro-3-methyldibenzofuran-4-yl)-1-methylquinolin-1-ium (PubChem CID 147549881) has the molecular formula C23H16F2NO+ and a molecular weight of 360.38 g/mol. Its IUPAC name is 2-(1,7-difluoro-3-methyldibenzofuran-4-yl)-1-methylquinolin-1-ium.
| Compound Name | 2-(1,7-difluoro-3-methyldibenzofuran-4-yl)-1-methylquinolin-1-ium |
|---|---|
| PubChem CID | 147549881 |
| Molecular Formula | C23H16F2NO+ |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 2-(1,7-difluoro-3-methyldibenzofuran-4-yl)-1-methylquinolin-1-ium |
| SMILES | Cc1cc(F)c2c(oc3cc(F)ccc32)c1-c1ccc2ccccc2[n+]1C |
| InChI | InChI=1S/C23H16F2NO/c1-13-11-17(25)22-16-9-8-15(24)12-20(16)27-23(22)21(13)19-10-7-14-5-3-4-6-18(14)26(19)2/h3-12H,1-2H3/q+1 |
| InChIKey | PJWQRIVKCRCCJZ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|