C27H26F2NOSi+ — CID 162494243
[4-deuterio-6-fluoro-2-(7-fluoro-2,3-dimethyldibenzofuran-4-yl)-1-methylquinolin-1-ium-7-yl]-trimethylsilane (PubChem CID 162494243) has the molecular formula C27H26F2NOSi+ and a molecular weight of 447.60 g/mol. Its IUPAC name is [4-deuterio-6-fluoro-2-(7-fluoro-2,3-dimethyldibenzofuran-4-yl)-1-methylquinolin-1-ium-7-yl]-trimethylsilane.
| Compound Name | [4-deuterio-6-fluoro-2-(7-fluoro-2,3-dimethyldibenzofuran-4-yl)-1-methylquinolin-1-ium-7-yl]-trimethylsilane |
|---|---|
| PubChem CID | 162494243 |
| Molecular Formula | C27H26F2NOSi+ |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | [4-deuterio-6-fluoro-2-(7-fluoro-2,3-dimethyldibenzofuran-4-yl)-1-methylquinolin-1-ium-7-yl]-trimethylsilane |
| SMILES | [2H]c1cc(-c2c(C)c(C)cc3c2oc2cc(F)ccc23)[n+](C)c2cc([Si](C)(C)C)c(F)cc12 |
| InChI | InChI=1S/C27H26F2NOSi/c1-15-11-20-19-9-8-18(28)13-24(19)31-27(20)26(16(15)2)22-10-7-17-12-21(29)25(32(4,5)6)14-23(17)30(22)3/h7-14H,1-6H3/q+1/i7D |
| InChIKey | RMTOJFSZEXCVSY-WHRKIXHSSA-N |
| XLogP | 6.67 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|