C33H39FNOSi+ — CID 163542204
[4-(2,2-dimethylpropyl)-2-(7-fluoro-2,3-dimethyldibenzofuran-4-yl)-1,7-dimethylquinolin-1-ium-6-yl]-trimethylsilane (PubChem CID 163542204) has the molecular formula C33H39FNOSi+ and a molecular weight of 512.77 g/mol. Its IUPAC name is [4-(2,2-dimethylpropyl)-2-(7-fluoro-2,3-dimethyldibenzofuran-4-yl)-1,7-dimethylquinolin-1-ium-6-yl]-trimethylsilane.
| Compound Name | [4-(2,2-dimethylpropyl)-2-(7-fluoro-2,3-dimethyldibenzofuran-4-yl)-1,7-dimethylquinolin-1-ium-6-yl]-trimethylsilane |
|---|---|
| PubChem CID | 163542204 |
| Molecular Formula | C33H39FNOSi+ |
| Molecular Weight | 512.77 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | [4-(2,2-dimethylpropyl)-2-(7-fluoro-2,3-dimethyldibenzofuran-4-yl)-1,7-dimethylquinolin-1-ium-6-yl]-trimethylsilane |
| SMILES | Cc1cc2c(cc1[Si](C)(C)C)c(CC(C)(C)C)cc(-c1c(C)c(C)cc3c1oc1cc(F)ccc13)[n+]2C |
| InChI | InChI=1S/C33H39FNOSi/c1-19-13-26-24-12-11-23(34)16-29(24)36-32(26)31(21(19)3)28-15-22(18-33(4,5)6)25-17-30(37(8,9)10)20(2)14-27(25)35(28)7/h11-17H,18H2,1-10H3/q+1 |
| InChIKey | APIJXRMBSVZBNL-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.77 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|