C35H39N2OSi+ — CID 164807978
[4-(cyclopentylmethyl)-2-(7-isocyano-2,3,6-trimethyldibenzofuran-4-yl)-1-methylquinolin-1-ium-6-yl]-trimethylsilane (PubChem CID 164807978) has the molecular formula C35H39N2OSi+ and a molecular weight of 531.80 g/mol. Its IUPAC name is [4-(cyclopentylmethyl)-2-(7-isocyano-2,3,6-trimethyldibenzofuran-4-yl)-1-methylquinolin-1-ium-6-yl]-trimethylsilane.
| Compound Name | [4-(cyclopentylmethyl)-2-(7-isocyano-2,3,6-trimethyldibenzofuran-4-yl)-1-methylquinolin-1-ium-6-yl]-trimethylsilane |
|---|---|
| PubChem CID | 164807978 |
| Molecular Formula | C35H39N2OSi+ |
| Molecular Weight | 531.80 g/mol |
| Exact Mass | 531.28 |
| IUPAC Name | [4-(cyclopentylmethyl)-2-(7-isocyano-2,3,6-trimethyldibenzofuran-4-yl)-1-methylquinolin-1-ium-6-yl]-trimethylsilane |
| SMILES | [C-]#[N+]c1ccc2c(oc3c(-c4cc(CC5CCCC5)c5cc([Si](C)(C)C)ccc5[n+]4C)c(C)c(C)cc32)c1C |
| InChI | InChI=1S/C35H39N2OSi/c1-21-17-29-27-14-15-30(36-4)23(3)34(27)38-35(29)33(22(21)2)32-19-25(18-24-11-9-10-12-24)28-20-26(39(6,7)8)13-16-31(28)37(32)5/h13-17,19-20,24H,9-12,18H2,1-3,5-8H3/q+1 |
| InChIKey | HEGPLUAIDJRPEX-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 21.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.80 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|