C26H32N+ — CID 166501241
4-(cyclopentylmethyl)-1,6-dimethyl-2-(2,3,5-trimethylphenyl)quinolin-1-ium (PubChem CID 166501241) has the molecular formula C26H32N+ and a molecular weight of 358.55 g/mol. Its IUPAC name is 4-(cyclopentylmethyl)-1,6-dimethyl-2-(2,3,5-trimethylphenyl)quinolin-1-ium.
| Compound Name | 4-(cyclopentylmethyl)-1,6-dimethyl-2-(2,3,5-trimethylphenyl)quinolin-1-ium |
|---|---|
| PubChem CID | 166501241 |
| Molecular Formula | C26H32N+ |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | 4-(cyclopentylmethyl)-1,6-dimethyl-2-(2,3,5-trimethylphenyl)quinolin-1-ium |
| SMILES | Cc1cc(C)c(C)c(-c2cc(CC3CCCC3)c3cc(C)ccc3[n+]2C)c1 |
| InChI | InChI=1S/C26H32N/c1-17-10-11-25-24(13-17)22(15-21-8-6-7-9-21)16-26(27(25)5)23-14-18(2)12-19(3)20(23)4/h10-14,16,21H,6-9,15H2,1-5H3/q+1 |
| InChIKey | UKYMNNLUZDLHCU-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|