C20H19N2+ — CID 166054780
5-isocyano-1-methyl-2-(2,3,5-trimethylphenyl)quinolin-1-ium (PubChem CID 166054780) has the molecular formula C20H19N2+ and a molecular weight of 287.39 g/mol. Its IUPAC name is 5-isocyano-1-methyl-2-(2,3,5-trimethylphenyl)quinolin-1-ium.
| Compound Name | 5-isocyano-1-methyl-2-(2,3,5-trimethylphenyl)quinolin-1-ium |
|---|---|
| PubChem CID | 166054780 |
| Molecular Formula | C20H19N2+ |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 5-isocyano-1-methyl-2-(2,3,5-trimethylphenyl)quinolin-1-ium |
| SMILES | [C-]#[N+]c1cccc2c1ccc(-c1cc(C)cc(C)c1C)[n+]2C |
| InChI | InChI=1S/C20H19N2/c1-13-11-14(2)15(3)17(12-13)20-10-9-16-18(21-4)7-6-8-19(16)22(20)5/h6-12H,1-3,5H3/q+1 |
| InChIKey | QOOXRSQTHGWCOX-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 8.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|