C32H26N3+ — CID 171459293
9-[1-methyl-2-(2,3,5-trimethylphenyl)quinolin-1-ium-5-yl]carbazole-1-carbonitrile (PubChem CID 171459293) has the molecular formula C32H26N3+ and a molecular weight of 452.58 g/mol. Its IUPAC name is 9-[1-methyl-2-(2,3,5-trimethylphenyl)quinolin-1-ium-5-yl]carbazole-1-carbonitrile.
| Compound Name | 9-[1-methyl-2-(2,3,5-trimethylphenyl)quinolin-1-ium-5-yl]carbazole-1-carbonitrile |
|---|---|
| PubChem CID | 171459293 |
| Molecular Formula | C32H26N3+ |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 9-[1-methyl-2-(2,3,5-trimethylphenyl)quinolin-1-ium-5-yl]carbazole-1-carbonitrile |
| SMILES | Cc1cc(C)c(C)c(-c2ccc3c(-n4c5ccccc5c5cccc(C#N)c54)cccc3[n+]2C)c1 |
| InChI | InChI=1S/C32H26N3/c1-20-17-21(2)22(3)27(18-20)29-16-15-26-28(34(29)4)13-8-14-31(26)35-30-12-6-5-10-24(30)25-11-7-9-23(19-33)32(25)35/h5-18H,1-4H3/q+1 |
| InChIKey | VEPPVQXMSSEZBQ-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 32.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|