C25H30N+ — CID 123592244
5-cyclohexyl-1-methyl-2-(2,3,5-trimethylphenyl)quinolin-1-ium (PubChem CID 123592244) has the molecular formula C25H30N+ and a molecular weight of 344.52 g/mol. Its IUPAC name is 5-cyclohexyl-1-methyl-2-(2,3,5-trimethylphenyl)quinolin-1-ium.
| Compound Name | 5-cyclohexyl-1-methyl-2-(2,3,5-trimethylphenyl)quinolin-1-ium |
|---|---|
| PubChem CID | 123592244 |
| Molecular Formula | C25H30N+ |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | 5-cyclohexyl-1-methyl-2-(2,3,5-trimethylphenyl)quinolin-1-ium |
| SMILES | Cc1cc(C)c(C)c(-c2ccc3c(C4CCCCC4)cccc3[n+]2C)c1 |
| InChI | InChI=1S/C25H30N/c1-17-15-18(2)19(3)23(16-17)25-14-13-22-21(20-9-6-5-7-10-20)11-8-12-24(22)26(25)4/h8,11-16,20H,5-7,9-10H2,1-4H3/q+1 |
| InChIKey | HFAONEUTJINKJU-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|