C27H34N+ — CID 140802297
4-(4,4-dimethylcyclohexyl)-1-methyl-2-(2,3,5-trimethylphenyl)quinolin-1-ium (PubChem CID 140802297) has the molecular formula C27H34N+ and a molecular weight of 372.58 g/mol. Its IUPAC name is 4-(4,4-dimethylcyclohexyl)-1-methyl-2-(2,3,5-trimethylphenyl)quinolin-1-ium.
| Compound Name | 4-(4,4-dimethylcyclohexyl)-1-methyl-2-(2,3,5-trimethylphenyl)quinolin-1-ium |
|---|---|
| PubChem CID | 140802297 |
| Molecular Formula | C27H34N+ |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | 4-(4,4-dimethylcyclohexyl)-1-methyl-2-(2,3,5-trimethylphenyl)quinolin-1-ium |
| SMILES | Cc1cc(C)c(C)c(-c2cc(C3CCC(C)(C)CC3)c3ccccc3[n+]2C)c1 |
| InChI | InChI=1S/C27H34N/c1-18-15-19(2)20(3)23(16-18)26-17-24(21-11-13-27(4,5)14-12-21)22-9-7-8-10-25(22)28(26)6/h7-10,15-17,21H,11-14H2,1-6H3/q+1 |
| InChIKey | FJGCIUOYHBUEEB-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|