C22H24N+ — CID 155642396
4,4,5,5,6,6-hexadeuterio-1-methyl-2-(2,3,5-trimethylphenyl)benzo[de]quinolin-1-ium (PubChem CID 155642396) has the molecular formula C22H24N+ and a molecular weight of 308.48 g/mol. Its IUPAC name is 4,4,5,5,6,6-hexadeuterio-1-methyl-2-(2,3,5-trimethylphenyl)benzo[de]quinolin-1-ium.
| Compound Name | 4,4,5,5,6,6-hexadeuterio-1-methyl-2-(2,3,5-trimethylphenyl)benzo[de]quinolin-1-ium |
|---|---|
| PubChem CID | 155642396 |
| Molecular Formula | C22H24N+ |
| Molecular Weight | 308.48 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | 4,4,5,5,6,6-hexadeuterio-1-methyl-2-(2,3,5-trimethylphenyl)benzo[de]quinolin-1-ium |
| SMILES | [2H]C1([2H])c2cccc3c2c(cc(-c2cc(C)cc(C)c2C)[n+]3C)C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C22H24N/c1-14-11-15(2)16(3)19(12-14)21-13-18-9-5-7-17-8-6-10-20(22(17)18)23(21)4/h6,8,10-13H,5,7,9H2,1-4H3/q+1/i5D2,7D2,9D2 |
| InChIKey | OAODORNXYJTVDJ-ILXHJTHPSA-N |
| XLogP | 4.75 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.48 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|