C19H19FN+ — CID 166501250
6-fluoro-1-methyl-2-(2,3,5-trimethylphenyl)quinolin-1-ium (PubChem CID 166501250) has the molecular formula C19H19FN+ and a molecular weight of 280.37 g/mol. Its IUPAC name is 6-fluoro-1-methyl-2-(2,3,5-trimethylphenyl)quinolin-1-ium.
| Compound Name | 6-fluoro-1-methyl-2-(2,3,5-trimethylphenyl)quinolin-1-ium |
|---|---|
| PubChem CID | 166501250 |
| Molecular Formula | C19H19FN+ |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 6-fluoro-1-methyl-2-(2,3,5-trimethylphenyl)quinolin-1-ium |
| SMILES | Cc1cc(C)c(C)c(-c2ccc3cc(F)ccc3[n+]2C)c1 |
| InChI | InChI=1S/C19H19FN/c1-12-9-13(2)14(3)17(10-12)19-7-5-15-11-16(20)6-8-18(15)21(19)4/h5-11H,1-4H3/q+1 |
| InChIKey | VNRCNJJTHDVMLX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|