C24H23FN+ — CID 158016116
4-deuterio-8-fluoro-2,3-dimethyl-1-(2,3,5-trimethylphenyl)benzo[h]isoquinolin-2-ium (PubChem CID 158016116) has the molecular formula C24H23FN+ and a molecular weight of 345.46 g/mol. Its IUPAC name is 4-deuterio-8-fluoro-2,3-dimethyl-1-(2,3,5-trimethylphenyl)benzo[h]isoquinolin-2-ium.
| Compound Name | 4-deuterio-8-fluoro-2,3-dimethyl-1-(2,3,5-trimethylphenyl)benzo[h]isoquinolin-2-ium |
|---|---|
| PubChem CID | 158016116 |
| Molecular Formula | C24H23FN+ |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 4-deuterio-8-fluoro-2,3-dimethyl-1-(2,3,5-trimethylphenyl)benzo[h]isoquinolin-2-ium |
| SMILES | [2H]c1c(C)[n+](C)c(-c2cc(C)cc(C)c2C)c2c1ccc1cc(F)ccc12 |
| InChI | InChI=1S/C24H23FN/c1-14-10-15(2)17(4)22(11-14)24-23-19(12-16(3)26(24)5)7-6-18-13-20(25)8-9-21(18)23/h6-13H,1-5H3/q+1/i12D |
| InChIKey | BKDUPVJHACHJAK-UQBWLURTSA-N |
| XLogP | 5.86 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|