C26H34N+ — CID 158690405
4-deuterio-2,3,7-trimethyl-6-pentan-3-yl-1-(2,3,5-trimethylphenyl)isoquinolin-2-ium (PubChem CID 158690405) has the molecular formula C26H34N+ and a molecular weight of 361.57 g/mol. Its IUPAC name is 4-deuterio-2,3,7-trimethyl-6-pentan-3-yl-1-(2,3,5-trimethylphenyl)isoquinolin-2-ium.
| Compound Name | 4-deuterio-2,3,7-trimethyl-6-pentan-3-yl-1-(2,3,5-trimethylphenyl)isoquinolin-2-ium |
|---|---|
| PubChem CID | 158690405 |
| Molecular Formula | C26H34N+ |
| Molecular Weight | 361.57 g/mol |
| Exact Mass | 361.27 |
| IUPAC Name | 4-deuterio-2,3,7-trimethyl-6-pentan-3-yl-1-(2,3,5-trimethylphenyl)isoquinolin-2-ium |
| SMILES | [2H]c1c(C)[n+](C)c(-c2cc(C)cc(C)c2C)c2cc(C)c(C(CC)CC)cc12 |
| InChI | InChI=1S/C26H34N/c1-9-21(10-2)23-15-22-14-19(6)27(8)26(25(22)13-18(23)5)24-12-16(3)11-17(4)20(24)7/h11-15,21H,9-10H2,1-8H3/q+1/i14D |
| InChIKey | BINMEKRIAQENKM-FCFVPJCTSA-N |
| XLogP | 6.78 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.57 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|