C25H32N+ — CID 123915658
2-methyl-6,7-di(propan-2-yl)-1-(2,3,5-trimethylphenyl)isoquinolin-2-ium (PubChem CID 123915658) has the molecular formula C25H32N+ and a molecular weight of 346.54 g/mol. Its IUPAC name is 2-methyl-6,7-di(propan-2-yl)-1-(2,3,5-trimethylphenyl)isoquinolin-2-ium.
| Compound Name | 2-methyl-6,7-di(propan-2-yl)-1-(2,3,5-trimethylphenyl)isoquinolin-2-ium |
|---|---|
| PubChem CID | 123915658 |
| Molecular Formula | C25H32N+ |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | 2-methyl-6,7-di(propan-2-yl)-1-(2,3,5-trimethylphenyl)isoquinolin-2-ium |
| SMILES | Cc1cc(C)c(C)c(-c2c3cc(C(C)C)c(C(C)C)cc3cc[n+]2C)c1 |
| InChI | InChI=1S/C25H32N/c1-15(2)21-13-20-9-10-26(8)25(24(20)14-22(21)16(3)4)23-12-17(5)11-18(6)19(23)7/h9-16H,1-8H3/q+1 |
| InChIKey | ZNMYXUOAIDWGFG-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|