C21H24N+ — CID 155638527
2,6-dimethyl-1-(2-methyl-5-propan-2-ylphenyl)isoquinolin-2-ium (PubChem CID 155638527) has the molecular formula C21H24N+ and a molecular weight of 290.43 g/mol. Its IUPAC name is 2,6-dimethyl-1-(2-methyl-5-propan-2-ylphenyl)isoquinolin-2-ium.
| Compound Name | 2,6-dimethyl-1-(2-methyl-5-propan-2-ylphenyl)isoquinolin-2-ium |
|---|---|
| PubChem CID | 155638527 |
| Molecular Formula | C21H24N+ |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 2,6-dimethyl-1-(2-methyl-5-propan-2-ylphenyl)isoquinolin-2-ium |
| SMILES | Cc1ccc2c(-c3cc(C(C)C)ccc3C)[n+](C)ccc2c1 |
| InChI | InChI=1S/C21H24N/c1-14(2)17-8-7-16(4)20(13-17)21-19-9-6-15(3)12-18(19)10-11-22(21)5/h6-14H,1-5H3/q+1 |
| InChIKey | NUIQYWOKMSDNFJ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|