C20H18NS+ — CID 155638438
2,6-dimethyl-1-(5-methyl-1-benzothiophen-6-yl)isoquinolin-2-ium (PubChem CID 155638438) has the molecular formula C20H18NS+ and a molecular weight of 304.44 g/mol. Its IUPAC name is 2,6-dimethyl-1-(5-methyl-1-benzothiophen-6-yl)isoquinolin-2-ium.
| Compound Name | 2,6-dimethyl-1-(5-methyl-1-benzothiophen-6-yl)isoquinolin-2-ium |
|---|---|
| PubChem CID | 155638438 |
| Molecular Formula | C20H18NS+ |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 2,6-dimethyl-1-(5-methyl-1-benzothiophen-6-yl)isoquinolin-2-ium |
| SMILES | Cc1ccc2c(-c3cc4sccc4cc3C)[n+](C)ccc2c1 |
| InChI | InChI=1S/C20H18NS/c1-13-4-5-17-15(10-13)6-8-21(3)20(17)18-12-19-16(7-9-22-19)11-14(18)2/h4-12H,1-3H3/q+1 |
| InChIKey | QOUDNWRYNSHYCO-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|