C25H26NS+ — CID 161425924
6-cyclopentyl-4-deuterio-2,3-dimethyl-1-(5-methyl-1-benzothiophen-6-yl)isoquinolin-2-ium (PubChem CID 161425924) has the molecular formula C25H26NS+ and a molecular weight of 373.56 g/mol. Its IUPAC name is 6-cyclopentyl-4-deuterio-2,3-dimethyl-1-(5-methyl-1-benzothiophen-6-yl)isoquinolin-2-ium.
| Compound Name | 6-cyclopentyl-4-deuterio-2,3-dimethyl-1-(5-methyl-1-benzothiophen-6-yl)isoquinolin-2-ium |
|---|---|
| PubChem CID | 161425924 |
| Molecular Formula | C25H26NS+ |
| Molecular Weight | 373.56 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 6-cyclopentyl-4-deuterio-2,3-dimethyl-1-(5-methyl-1-benzothiophen-6-yl)isoquinolin-2-ium |
| SMILES | [2H]c1c(C)[n+](C)c(-c2cc3sccc3cc2C)c2ccc(C3CCCC3)cc12 |
| InChI | InChI=1S/C25H26NS/c1-16-12-20-10-11-27-24(20)15-23(16)25-22-9-8-19(18-6-4-5-7-18)14-21(22)13-17(2)26(25)3/h8-15,18H,4-7H2,1-3H3/q+1/i13D |
| InChIKey | KURSQBDQDHTBCS-YSOHJTORSA-N |
| XLogP | 6.82 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.56 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|