C26H31FN+ — CID 158314421
6-cyclohexyl-4-deuterio-1-(4-fluoro-2,3,5-trimethylphenyl)-2,3-dimethylisoquinolin-2-ium (PubChem CID 158314421) has the molecular formula C26H31FN+ and a molecular weight of 377.55 g/mol. Its IUPAC name is 6-cyclohexyl-4-deuterio-1-(4-fluoro-2,3,5-trimethylphenyl)-2,3-dimethylisoquinolin-2-ium.
| Compound Name | 6-cyclohexyl-4-deuterio-1-(4-fluoro-2,3,5-trimethylphenyl)-2,3-dimethylisoquinolin-2-ium |
|---|---|
| PubChem CID | 158314421 |
| Molecular Formula | C26H31FN+ |
| Molecular Weight | 377.55 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | 6-cyclohexyl-4-deuterio-1-(4-fluoro-2,3,5-trimethylphenyl)-2,3-dimethylisoquinolin-2-ium |
| SMILES | [2H]c1c(C)[n+](C)c(-c2cc(C)c(F)c(C)c2C)c2ccc(C3CCCCC3)cc12 |
| InChI | InChI=1S/C26H31FN/c1-16-13-24(18(3)19(4)25(16)27)26-23-12-11-21(20-9-7-6-8-10-20)15-22(23)14-17(2)28(26)5/h11-15,20H,6-10H2,1-5H3/q+1/i14D |
| InChIKey | TTXGTQDOYFEPSY-FCFVPJCTSA-N |
| XLogP | 6.75 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.55 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|