C21H23FN+ — CID 159832674
1-(4-fluoro-2,3,5-trimethylphenyl)-2,3,7-trimethylisoquinolin-2-ium (PubChem CID 159832674) has the molecular formula C21H23FN+ and a molecular weight of 308.42 g/mol. Its IUPAC name is 1-(4-fluoro-2,3,5-trimethylphenyl)-2,3,7-trimethylisoquinolin-2-ium.
| Compound Name | 1-(4-fluoro-2,3,5-trimethylphenyl)-2,3,7-trimethylisoquinolin-2-ium |
|---|---|
| PubChem CID | 159832674 |
| Molecular Formula | C21H23FN+ |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 1-(4-fluoro-2,3,5-trimethylphenyl)-2,3,7-trimethylisoquinolin-2-ium |
| SMILES | Cc1ccc2cc(C)[n+](C)c(-c3cc(C)c(F)c(C)c3C)c2c1 |
| InChI | InChI=1S/C21H23FN/c1-12-7-8-17-11-14(3)23(6)21(19(17)9-12)18-10-13(2)20(22)16(5)15(18)4/h7-11H,1-6H3/q+1 |
| InChIKey | HSRZVMHGGXHCNO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|