C21H24N+ — CID 157467643
1-(5-ethyl-2-methylphenyl)-2,3,7-trimethylisoquinolin-2-ium (PubChem CID 157467643) has the molecular formula C21H24N+ and a molecular weight of 290.43 g/mol. Its IUPAC name is 1-(5-ethyl-2-methylphenyl)-2,3,7-trimethylisoquinolin-2-ium.
| Compound Name | 1-(5-ethyl-2-methylphenyl)-2,3,7-trimethylisoquinolin-2-ium |
|---|---|
| PubChem CID | 157467643 |
| Molecular Formula | C21H24N+ |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 1-(5-ethyl-2-methylphenyl)-2,3,7-trimethylisoquinolin-2-ium |
| SMILES | CCc1ccc(C)c(-c2c3cc(C)ccc3cc(C)[n+]2C)c1 |
| InChI | InChI=1S/C21H24N/c1-6-17-9-8-15(3)19(13-17)21-20-11-14(2)7-10-18(20)12-16(4)22(21)5/h7-13H,6H2,1-5H3/q+1 |
| InChIKey | YXHIUXHHNXDSFT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|