C18H24 — CID 142969887
4-ethyl-1,2-dimethylbenzene;1,4-xylene (PubChem CID 142969887) has the molecular formula C18H24 and a molecular weight of 240.39 g/mol. Its IUPAC name is 4-ethyl-1,2-dimethylbenzene;1,4-xylene.
| Compound Name | 4-ethyl-1,2-dimethylbenzene;1,4-xylene |
|---|---|
| PubChem CID | 142969887 |
| Molecular Formula | C18H24 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | 4-ethyl-1,2-dimethylbenzene;1,4-xylene |
| SMILES | CCc1ccc(C)c(C)c1.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C10H14.C8H10/c1-4-10-6-5-8(2)9(3)7-10;1-7-3-5-8(2)6-4-7/h5-7H,4H2,1-3H3;3-6H,1-2H3 |
| InChIKey | MXZGJTQBRRMTFZ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |