C32H37P — CID 143532331
[4-[(3,4-dimethylphenyl)methyl]phenyl]-methyl-(4-methylphenyl)phosphane;1,2,4-trimethylbenzene (PubChem CID 143532331) has the molecular formula C32H37P and a molecular weight of 452.62 g/mol. Its IUPAC name is [4-[(3,4-dimethylphenyl)methyl]phenyl]-methyl-(4-methylphenyl)phosphane;1,2,4-trimethylbenzene.
| Compound Name | [4-[(3,4-dimethylphenyl)methyl]phenyl]-methyl-(4-methylphenyl)phosphane;1,2,4-trimethylbenzene |
|---|---|
| PubChem CID | 143532331 |
| Molecular Formula | C32H37P |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | [4-[(3,4-dimethylphenyl)methyl]phenyl]-methyl-(4-methylphenyl)phosphane;1,2,4-trimethylbenzene |
| SMILES | Cc1ccc(C)c(C)c1.Cc1ccc(P(C)c2ccc(Cc3ccc(C)c(C)c3)cc2)cc1 |
| InChI | InChI=1S/C23H25P.C9H12/c1-17-5-11-22(12-6-17)24(4)23-13-9-20(10-14-23)16-21-8-7-18(2)19(3)15-21;1-7-4-5-8(2)9(3)6-7/h5-15H,16H2,1-4H3;4-6H,1-3H3 |
| InChIKey | JMXVFKRBWDMGED-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|