About azane;1,2,4-trimethylbenzene;hydrochloride
azane;1,2,4-trimethylbenzene;hydrochloride (PubChem CID 174988554) has the molecular formula C9H16ClN
and a molecular weight of 173.69 g/mol. Its IUPAC name is azane;1,2,4-trimethylbenzene;hydrochloride.
Molecular Properties
| Compound Name | azane;1,2,4-trimethylbenzene;hydrochloride |
| PubChem CID | 174988554 |
| Molecular Formula | C9H16ClN |
| Molecular Weight | 173.69 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | azane;1,2,4-trimethylbenzene;hydrochloride |
| SMILES | Cc1ccc(C)c(C)c1.Cl.N |
| InChI | InChI=1S/C9H12.ClH.H3N/c1-7-4-5-8(2)9(3)6-7;;/h4-6H,1-3H3;1H;1H3 |
| InChIKey | PHKOHFHAJHSNNL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.69 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze azane;1,2,4-trimethylbenzene;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1,2,4-trimethylbenzene;hydrochloride?
The IUPAC name of azane;1,2,4-trimethylbenzene;hydrochloride (CID 174988554) is azane;1,2,4-trimethylbenzene;hydrochloride.
What is the SMILES notation for azane;1,2,4-trimethylbenzene;hydrochloride?
The canonical SMILES for azane;1,2,4-trimethylbenzene;hydrochloride is Cc1ccc(C)c(C)c1.Cl.N.
What is the InChIKey of azane;1,2,4-trimethylbenzene;hydrochloride?
The InChIKey is PHKOHFHAJHSNNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.ClH.H3N/c1-7-4-5-8(2)9(3)6-7;;/h4-6H,1-3H3;1H;1H3.
What are the key properties of azane;1,2,4-trimethylbenzene;hydrochloride?
azane;1,2,4-trimethylbenzene;hydrochloride has a molecular weight of 173.69 g/mol, XLogP of 3.20, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1,2,4-trimethylbenzene;hydrochloride is sourced from PubChem (CID 174988554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).