C36H48 — CID 157447220
1,2,3,5-tetramethylbenzene;bis(1,2,4-trimethylbenzene);1,4-xylene (PubChem CID 157447220) has the molecular formula C36H48 and a molecular weight of 480.78 g/mol. Its IUPAC name is 1,2,3,5-tetramethylbenzene;bis(1,2,4-trimethylbenzene);1,4-xylene.
| Compound Name | 1,2,3,5-tetramethylbenzene;bis(1,2,4-trimethylbenzene);1,4-xylene |
|---|---|
| PubChem CID | 157447220 |
| Molecular Formula | C36H48 |
| Molecular Weight | 480.78 g/mol |
| Exact Mass | 480.38 |
| IUPAC Name | 1,2,3,5-tetramethylbenzene;bis(1,2,4-trimethylbenzene);1,4-xylene |
| SMILES | Cc1cc(C)c(C)c(C)c1.Cc1ccc(C)c(C)c1.Cc1ccc(C)c(C)c1.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C10H14.2C9H12.C8H10/c1-7-5-8(2)10(4)9(3)6-7;2*1-7-4-5-8(2)9(3)6-7;1-7-3-5-8(2)6-4-7/h5-6H,1-4H3;2*4-6H,1-3H3;3-6H,1-2H3 |
| InChIKey | BSJBZQQQHKWMEG-UHFFFAOYSA-N |
| XLogP | 10.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.78 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |