C10H13N — CID 90728107
formonitrile;1,2,4-trimethylbenzene (PubChem CID 90728107) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is formonitrile;1,2,4-trimethylbenzene.
| Compound Name | formonitrile;1,2,4-trimethylbenzene |
|---|---|
| PubChem CID | 90728107 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | formonitrile;1,2,4-trimethylbenzene |
| SMILES | C#N.Cc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C9H12.CHN/c1-7-4-5-8(2)9(3)6-7;1-2/h4-6H,1-3H3;1H |
| InChIKey | TVSVKZNLDZECIT-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |