C14H27F — CID 143343895
ethane;fluoromethane;1,2,4-trimethylbenzene (PubChem CID 143343895) has the molecular formula C14H27F and a molecular weight of 214.37 g/mol. Its IUPAC name is ethane;fluoromethane;1,2,4-trimethylbenzene.
| Compound Name | ethane;fluoromethane;1,2,4-trimethylbenzene |
|---|---|
| PubChem CID | 143343895 |
| Molecular Formula | C14H27F |
| Molecular Weight | 214.37 g/mol |
| Exact Mass | 214.21 |
| IUPAC Name | ethane;fluoromethane;1,2,4-trimethylbenzene |
| SMILES | CC.CC.CF.Cc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C9H12.2C2H6.CH3F/c1-7-4-5-8(2)9(3)6-7;3*1-2/h4-6H,1-3H3;2*1-2H3;1H3 |
| InChIKey | YTKPRLJTLQIXEV-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.37 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |