C16H18F2 — CID 143291737
1,4-difluoro-2-methylbenzene;1,2,4-trimethylbenzene (PubChem CID 143291737) has the molecular formula C16H18F2 and a molecular weight of 248.32 g/mol. Its IUPAC name is 1,4-difluoro-2-methylbenzene;1,2,4-trimethylbenzene.
| Compound Name | 1,4-difluoro-2-methylbenzene;1,2,4-trimethylbenzene |
|---|---|
| PubChem CID | 143291737 |
| Molecular Formula | C16H18F2 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 1,4-difluoro-2-methylbenzene;1,2,4-trimethylbenzene |
| SMILES | Cc1cc(F)ccc1F.Cc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C9H12.C7H6F2/c1-7-4-5-8(2)9(3)6-7;1-5-4-6(8)2-3-7(5)9/h4-6H,1-3H3;2-4H,1H3 |
| InChIKey | GUJDQCWQRMXOON-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |