C10H17F — CID 157153921
2-fluoro-1,4-dimethylbenzene;methane (PubChem CID 157153921) has the molecular formula C10H17F and a molecular weight of 156.24 g/mol. Its IUPAC name is 2-fluoro-1,4-dimethylbenzene;methane.
| Compound Name | 2-fluoro-1,4-dimethylbenzene;methane |
|---|---|
| PubChem CID | 157153921 |
| Molecular Formula | C10H17F |
| Molecular Weight | 156.24 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 2-fluoro-1,4-dimethylbenzene;methane |
| SMILES | C.C.Cc1ccc(C)c(F)c1 |
| InChI | InChI=1S/C8H9F.2CH4/c1-6-3-4-7(2)8(9)5-6;;/h3-5H,1-2H3;2*1H4 |
| InChIKey | ALOVMDZLWODLPQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.24 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |