C8H10ClF — CID 143804441
2-fluoro-1,4-dimethylbenzene;hydrochloride (PubChem CID 143804441) has the molecular formula C8H10ClF and a molecular weight of 160.62 g/mol. Its IUPAC name is 2-fluoro-1,4-dimethylbenzene;hydrochloride.
| Compound Name | 2-fluoro-1,4-dimethylbenzene;hydrochloride |
|---|---|
| PubChem CID | 143804441 |
| Molecular Formula | C8H10ClF |
| Molecular Weight | 160.62 g/mol |
| Exact Mass | 160.05 |
| IUPAC Name | 2-fluoro-1,4-dimethylbenzene;hydrochloride |
| SMILES | Cc1ccc(C)c(F)c1.Cl |
| InChI | InChI=1S/C8H9F.ClH/c1-6-3-4-7(2)8(9)5-6;/h3-5H,1-2H3;1H |
| InChIKey | DRUINFGASRSTGB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.62 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |