C14H23FO — CID 145318169
ethene;2-fluoro-1,4-dimethylbenzene;2-methylpropan-2-ol (PubChem CID 145318169) has the molecular formula C14H23FO and a molecular weight of 226.33 g/mol. Its IUPAC name is ethene;2-fluoro-1,4-dimethylbenzene;2-methylpropan-2-ol.
| Compound Name | ethene;2-fluoro-1,4-dimethylbenzene;2-methylpropan-2-ol |
|---|---|
| PubChem CID | 145318169 |
| Molecular Formula | C14H23FO |
| Molecular Weight | 226.33 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | ethene;2-fluoro-1,4-dimethylbenzene;2-methylpropan-2-ol |
| SMILES | C=C.CC(C)(C)O.Cc1ccc(C)c(F)c1 |
| InChI | InChI=1S/C8H9F.C4H10O.C2H4/c1-6-3-4-7(2)8(9)5-6;1-4(2,3)5;1-2/h3-5H,1-2H3;5H,1-3H3;1-2H2 |
| InChIKey | JIHVMACDQJNRBN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.33 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|